3-[(3-chlorophenyl)methoxy]-4-methoxybenzaldehyde
Chemical Structure Depiction of
3-[(3-chlorophenyl)methoxy]-4-methoxybenzaldehyde
3-[(3-chlorophenyl)methoxy]-4-methoxybenzaldehyde
Compound characteristics
| Compound ID: | 8011-8487 |
| Compound Name: | 3-[(3-chlorophenyl)methoxy]-4-methoxybenzaldehyde |
| Molecular Weight: | 276.72 |
| Molecular Formula: | C15 H13 Cl O3 |
| Smiles: | COc1ccc(C=O)cc1OCc1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.3253 |
| logD: | 3.3253 |
| logSw: | -3.608 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.3423 |
| InChI Key: | PKGAYSJHJKNIJF-UHFFFAOYSA-N |