(3,4-difluorophenyl){4-[4-fluoro-5-(4-methylpiperidin-1-yl)-2-nitrophenyl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(3,4-difluorophenyl){4-[4-fluoro-5-(4-methylpiperidin-1-yl)-2-nitrophenyl]piperazin-1-yl}methanone
(3,4-difluorophenyl){4-[4-fluoro-5-(4-methylpiperidin-1-yl)-2-nitrophenyl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | 8011-9160 |
| Compound Name: | (3,4-difluorophenyl){4-[4-fluoro-5-(4-methylpiperidin-1-yl)-2-nitrophenyl]piperazin-1-yl}methanone |
| Molecular Weight: | 462.47 |
| Molecular Formula: | C23 H25 F3 N4 O3 |
| Smiles: | CC1CCN(CC1)c1cc(c(cc1F)[N+]([O-])=O)N1CCN(CC1)C(c1ccc(c(c1)F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4233 |
| logD: | 4.4233 |
| logSw: | -4.4464 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.078 |
| InChI Key: | PQNOUHZZYKYDAF-UHFFFAOYSA-N |