ethyl 2-(3,4,5-trimethoxybenzamido)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-(3,4,5-trimethoxybenzamido)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate
ethyl 2-(3,4,5-trimethoxybenzamido)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate
Compound characteristics
| Compound ID: | 8011-9248 |
| Compound Name: | ethyl 2-(3,4,5-trimethoxybenzamido)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| Molecular Weight: | 433.52 |
| Molecular Formula: | C22 H27 N O6 S |
| Smiles: | CCOC(c1c2CCCCCc2sc1NC(c1cc(c(c(c1)OC)OC)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4162 |
| logD: | 2.2977 |
| logSw: | -4.323 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.107 |
| InChI Key: | WPZTVMZYDFKHNX-UHFFFAOYSA-N |