4-butanoylphenyl 2,3,3,3-tetrafluoro-2-methoxypropanoate
Chemical Structure Depiction of
4-butanoylphenyl 2,3,3,3-tetrafluoro-2-methoxypropanoate
4-butanoylphenyl 2,3,3,3-tetrafluoro-2-methoxypropanoate
Compound characteristics
| Compound ID: | 8012-0246 |
| Compound Name: | 4-butanoylphenyl 2,3,3,3-tetrafluoro-2-methoxypropanoate |
| Molecular Weight: | 322.25 |
| Molecular Formula: | C14 H14 F4 O4 |
| Smiles: | CCCC(c1ccc(cc1)OC(C(C(F)(F)F)(OC)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6151 |
| logD: | 3.6151 |
| logSw: | -3.7686 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.766 |
| InChI Key: | JSHRYALWADGWMI-ZDUSSCGKSA-N |