(2,3-difluorophenyl)(piperidin-1-yl)methanone
Chemical Structure Depiction of
(2,3-difluorophenyl)(piperidin-1-yl)methanone
(2,3-difluorophenyl)(piperidin-1-yl)methanone
Compound characteristics
| Compound ID: | 8012-0365 |
| Compound Name: | (2,3-difluorophenyl)(piperidin-1-yl)methanone |
| Molecular Weight: | 225.24 |
| Molecular Formula: | C12 H13 F2 N O |
| Smiles: | C1CCN(CC1)C(c1cccc(c1F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5377 |
| logD: | 2.5377 |
| logSw: | -2.7008 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 16.8867 |
| InChI Key: | PJIJKWKKKLUZQB-UHFFFAOYSA-N |