ethyl N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-[(ethoxycarbonyl)amino]-3,3,3-trifluoroalaninate
Chemical Structure Depiction of
ethyl N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-[(ethoxycarbonyl)amino]-3,3,3-trifluoroalaninate
ethyl N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-[(ethoxycarbonyl)amino]-3,3,3-trifluoroalaninate
Compound characteristics
| Compound ID: | 8012-0615 |
| Compound Name: | ethyl N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-[(ethoxycarbonyl)amino]-3,3,3-trifluoroalaninate |
| Molecular Weight: | 381.37 |
| Molecular Formula: | C14 H18 F3 N3 O4 S |
| Smiles: | CCOC(C(C(F)(F)F)(NC(=O)OCC)Nc1nc(cs1)C1CC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8671 |
| logD: | 3.5133 |
| logSw: | -3.8302 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.931 |
| InChI Key: | ADSCMZREABQCEW-ZDUSSCGKSA-N |