1-(3,4-dimethylphenyl)-5-{[(2-fluorophenyl)methyl]sulfanyl}-1H-tetrazole
Chemical Structure Depiction of
1-(3,4-dimethylphenyl)-5-{[(2-fluorophenyl)methyl]sulfanyl}-1H-tetrazole
1-(3,4-dimethylphenyl)-5-{[(2-fluorophenyl)methyl]sulfanyl}-1H-tetrazole
Compound characteristics
| Compound ID: | 8012-1545 |
| Compound Name: | 1-(3,4-dimethylphenyl)-5-{[(2-fluorophenyl)methyl]sulfanyl}-1H-tetrazole |
| Molecular Weight: | 314.38 |
| Molecular Formula: | C16 H15 F N4 S |
| Smiles: | Cc1ccc(cc1C)n1c(nnn1)SCc1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 4.9114 |
| logD: | 4.9114 |
| logSw: | -4.6737 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.889 |
| InChI Key: | ABTAJBGXZSOEKX-UHFFFAOYSA-N |