methyl 1-[2-(4-ethylphenoxy)ethyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate
Chemical Structure Depiction of
methyl 1-[2-(4-ethylphenoxy)ethyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate
methyl 1-[2-(4-ethylphenoxy)ethyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate
Compound characteristics
| Compound ID: | 8012-2436 |
| Compound Name: | methyl 1-[2-(4-ethylphenoxy)ethyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate |
| Molecular Weight: | 353.42 |
| Molecular Formula: | C21 H23 N O4 |
| Smiles: | CCc1ccc(cc1)OCCn1c(C)c(C(=O)OC)c2cc(ccc12)O |
| Stereo: | ACHIRAL |
| logP: | 4.6636 |
| logD: | 4.6619 |
| logSw: | -4.3755 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.626 |
| InChI Key: | AIFFICXGFXXBMX-UHFFFAOYSA-N |