2-(2-imino-3-methyl-2,3-dihydro-1H-benzimidazol-1-yl)-1-(4-methoxyphenyl)ethan-1-one--hydrogen bromide (1/1)
Chemical Structure Depiction of
2-(2-imino-3-methyl-2,3-dihydro-1H-benzimidazol-1-yl)-1-(4-methoxyphenyl)ethan-1-one--hydrogen bromide (1/1)
2-(2-imino-3-methyl-2,3-dihydro-1H-benzimidazol-1-yl)-1-(4-methoxyphenyl)ethan-1-one--hydrogen bromide (1/1)
Compound characteristics
| Compound ID: | 8012-3457 |
| Compound Name: | 2-(2-imino-3-methyl-2,3-dihydro-1H-benzimidazol-1-yl)-1-(4-methoxyphenyl)ethan-1-one--hydrogen bromide (1/1) |
| Molecular Weight: | 376.25 |
| Molecular Formula: | C17 H17 N3 O2 |
| Salt: | HBr |
| Smiles: | CN1C(=N)N(CC(c2ccc(cc2)OC)=O)c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 2.3717 |
| logD: | 1.1979 |
| logSw: | -2.7252 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.41 |
| InChI Key: | GCVWCDCXFXVXIR-UHFFFAOYSA-N |