2-[(pyridin-2-yl)sulfanyl]-N-[4-(trifluoromethoxy)phenyl]acetamide
Chemical Structure Depiction of
2-[(pyridin-2-yl)sulfanyl]-N-[4-(trifluoromethoxy)phenyl]acetamide
2-[(pyridin-2-yl)sulfanyl]-N-[4-(trifluoromethoxy)phenyl]acetamide
Compound characteristics
| Compound ID: | 8012-3505 |
| Compound Name: | 2-[(pyridin-2-yl)sulfanyl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| Molecular Weight: | 328.31 |
| Molecular Formula: | C14 H11 F3 N2 O2 S |
| Smiles: | C(C(Nc1ccc(cc1)OC(F)(F)F)=O)Sc1ccccn1 |
| Stereo: | ACHIRAL |
| logP: | 3.6384 |
| logD: | 3.6384 |
| logSw: | -4.0264 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.462 |
| InChI Key: | HPSWORWBIXWDDC-UHFFFAOYSA-N |