3-[(2,1,3-benzothiadiazole-4-sulfonyl)amino]-3-phenylpropanoic acid
Chemical Structure Depiction of
3-[(2,1,3-benzothiadiazole-4-sulfonyl)amino]-3-phenylpropanoic acid
3-[(2,1,3-benzothiadiazole-4-sulfonyl)amino]-3-phenylpropanoic acid
Compound characteristics
| Compound ID: | 8012-3515 |
| Compound Name: | 3-[(2,1,3-benzothiadiazole-4-sulfonyl)amino]-3-phenylpropanoic acid |
| Molecular Weight: | 363.41 |
| Molecular Formula: | C15 H13 N3 O4 S2 |
| Smiles: | C(C(c1ccccc1)NS(c1cccc2c1nsn2)(=O)=O)C(O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2363 |
| logD: | -0.5646 |
| logSw: | -2.6583 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 91.177 |
| InChI Key: | ILVSDKKZQSSNPC-LBPRGKRZSA-N |