6-amino-4-(4-chlorophenyl)-3-(thiophen-2-yl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
Chemical Structure Depiction of
6-amino-4-(4-chlorophenyl)-3-(thiophen-2-yl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
6-amino-4-(4-chlorophenyl)-3-(thiophen-2-yl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
Compound characteristics
| Compound ID: | 8012-3517 |
| Compound Name: | 6-amino-4-(4-chlorophenyl)-3-(thiophen-2-yl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| Molecular Weight: | 354.82 |
| Molecular Formula: | C17 H11 Cl N4 O S |
| Smiles: | C(C1C(c2ccc(cc2)[Cl])c2c(c3cccs3)n[nH]c2OC=1N)#N |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4786 |
| logD: | 3.4786 |
| logSw: | -4.4987 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 71.492 |
| InChI Key: | GHYXFRVJACDQSB-ZDUSSCGKSA-N |