2-{[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl}-N-(naphthalen-2-yl)acetamide
Chemical Structure Depiction of
2-{[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl}-N-(naphthalen-2-yl)acetamide
2-{[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl}-N-(naphthalen-2-yl)acetamide
Compound characteristics
| Compound ID: | 8012-5002 |
| Compound Name: | 2-{[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl}-N-(naphthalen-2-yl)acetamide |
| Molecular Weight: | 353.41 |
| Molecular Formula: | C20 H16 F N O2 S |
| Smiles: | C(C(c1ccc(cc1)F)=O)SCC(Nc1ccc2ccccc2c1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5541 |
| logD: | 4.5541 |
| logSw: | -4.9788 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.092 |
| InChI Key: | UIBSJDGHBLIGIA-UHFFFAOYSA-N |