2-{[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl}-N-(naphthalen-2-yl)acetamide
Chemical Structure Depiction of
2-{[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl}-N-(naphthalen-2-yl)acetamide
2-{[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl}-N-(naphthalen-2-yl)acetamide
Compound characteristics
| Compound ID: | 8012-5004 |
| Compound Name: | 2-{[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl}-N-(naphthalen-2-yl)acetamide |
| Molecular Weight: | 378.49 |
| Molecular Formula: | C22 H22 N2 O2 S |
| Smiles: | Cc1cccc(c1C)NC(CSCC(Nc1ccc2ccccc2c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0726 |
| logD: | 5.0726 |
| logSw: | -5.6448 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.296 |
| InChI Key: | JMZOFBDZNVZZHJ-UHFFFAOYSA-N |