5-chloro-2-methoxy-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide
Chemical Structure Depiction of
5-chloro-2-methoxy-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide
5-chloro-2-methoxy-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide
Compound characteristics
| Compound ID: | 8012-5156 |
| Compound Name: | 5-chloro-2-methoxy-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide |
| Molecular Weight: | 342.82 |
| Molecular Formula: | C19 H19 Cl N2 O2 |
| Smiles: | Cc1c(CCNC(c2cc(ccc2OC)[Cl])=O)c2ccccc2[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 4.1 |
| logD: | 4.0998 |
| logSw: | -4.5794 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.05 |
| InChI Key: | QHVQKCTUKJKOFI-UHFFFAOYSA-N |