N-(2-hydroxyethyl)-2-methyl-5-{4-[4-(trifluoromethoxy)anilino]phthalazin-1-yl}benzene-1-sulfonamide
Chemical Structure Depiction of
N-(2-hydroxyethyl)-2-methyl-5-{4-[4-(trifluoromethoxy)anilino]phthalazin-1-yl}benzene-1-sulfonamide
N-(2-hydroxyethyl)-2-methyl-5-{4-[4-(trifluoromethoxy)anilino]phthalazin-1-yl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8012-5458 |
| Compound Name: | N-(2-hydroxyethyl)-2-methyl-5-{4-[4-(trifluoromethoxy)anilino]phthalazin-1-yl}benzene-1-sulfonamide |
| Molecular Weight: | 518.51 |
| Molecular Formula: | C24 H21 F3 N4 O4 S |
| Smiles: | Cc1ccc(cc1S(NCCO)(=O)=O)c1c2ccccc2c(Nc2ccc(cc2)OC(F)(F)F)nn1 |
| Stereo: | ACHIRAL |
| logP: | 5.0568 |
| logD: | 5.056 |
| logSw: | -4.7383 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 96.225 |
| InChI Key: | SXQNLHOHCFLVGM-UHFFFAOYSA-N |