ethyl 1-(4-methoxy-1,2,5-oxadiazol-3-yl)-5-phenyl-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
ethyl 1-(4-methoxy-1,2,5-oxadiazol-3-yl)-5-phenyl-1H-1,2,3-triazole-4-carboxylate
ethyl 1-(4-methoxy-1,2,5-oxadiazol-3-yl)-5-phenyl-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | 8012-5750 |
| Compound Name: | ethyl 1-(4-methoxy-1,2,5-oxadiazol-3-yl)-5-phenyl-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 315.29 |
| Molecular Formula: | C14 H13 N5 O4 |
| Smiles: | CCOC(c1c(c2ccccc2)n(c2c(non2)OC)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7558 |
| logD: | 2.7558 |
| logSw: | -2.6985 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 90.445 |
| InChI Key: | YXABGJUZVOQSKH-UHFFFAOYSA-N |