2-{[(4-fluorophenyl)methyl]sulfanyl}-N-phenylacetamide
Chemical Structure Depiction of
2-{[(4-fluorophenyl)methyl]sulfanyl}-N-phenylacetamide
2-{[(4-fluorophenyl)methyl]sulfanyl}-N-phenylacetamide
Compound characteristics
| Compound ID: | 8012-6178 |
| Compound Name: | 2-{[(4-fluorophenyl)methyl]sulfanyl}-N-phenylacetamide |
| Molecular Weight: | 275.34 |
| Molecular Formula: | C15 H14 F N O S |
| Smiles: | C(C(Nc1ccccc1)=O)SCc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 3.458 |
| logD: | 3.458 |
| logSw: | -3.6487 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.1162 |
| InChI Key: | LYIJFZPGMKYJEK-UHFFFAOYSA-N |