2,3,5-trichloro-N-(4-methylphenyl)-6-(trifluoromethyl)pyridin-4-amine
Chemical Structure Depiction of
2,3,5-trichloro-N-(4-methylphenyl)-6-(trifluoromethyl)pyridin-4-amine
2,3,5-trichloro-N-(4-methylphenyl)-6-(trifluoromethyl)pyridin-4-amine
Compound characteristics
| Compound ID: | 8012-6230 |
| Compound Name: | 2,3,5-trichloro-N-(4-methylphenyl)-6-(trifluoromethyl)pyridin-4-amine |
| Molecular Weight: | 355.57 |
| Molecular Formula: | C13 H8 Cl3 F3 N2 |
| Smiles: | Cc1ccc(cc1)Nc1c(c(C(F)(F)F)nc(c1[Cl])[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.5104 |
| logD: | 5.5104 |
| logSw: | -5.999 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 17.7788 |
| InChI Key: | AAFLDTULUOZVRP-UHFFFAOYSA-N |