6-deoxy-N-[3-nitro-5-(phenylsulfanyl)phenyl]hexopyranosylamine
Chemical Structure Depiction of
6-deoxy-N-[3-nitro-5-(phenylsulfanyl)phenyl]hexopyranosylamine
6-deoxy-N-[3-nitro-5-(phenylsulfanyl)phenyl]hexopyranosylamine
Compound characteristics
| Compound ID: | 8012-6802 |
| Compound Name: | 6-deoxy-N-[3-nitro-5-(phenylsulfanyl)phenyl]hexopyranosylamine |
| Molecular Weight: | 392.43 |
| Molecular Formula: | C18 H20 N2 O6 S |
| Smiles: | CC1C(C(C(C(Nc2cc(cc(c2)Sc2ccccc2)[N+]([O-])=O)O1)O)O)O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.5829 |
| logD: | 2.5829 |
| logSw: | -2.7866 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 98.721 |
| InChI Key: | FLTTUASWHSPFOB-UHFFFAOYSA-N |