3,3,3-trifluoro-N-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)propanamide
Chemical Structure Depiction of
3,3,3-trifluoro-N-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)propanamide
3,3,3-trifluoro-N-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)propanamide
Compound characteristics
| Compound ID: | 8012-7051 |
| Compound Name: | 3,3,3-trifluoro-N-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)propanamide |
| Molecular Weight: | 355.16 |
| Molecular Formula: | C11 H6 F9 N O2 |
| Smiles: | c1cc(ccc1NC(C(C(F)(F)F)C(F)(F)F)=O)OC(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 4.5747 |
| logD: | 4.5747 |
| logSw: | -4.5928 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.5379 |
| InChI Key: | YTDLCXQGMCBVPE-UHFFFAOYSA-N |