2-{[4-amino-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(2,6-dichlorophenyl)acetamide
Chemical Structure Depiction of
2-{[4-amino-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(2,6-dichlorophenyl)acetamide
2-{[4-amino-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(2,6-dichlorophenyl)acetamide
Compound characteristics
| Compound ID: | 8012-7277 |
| Compound Name: | 2-{[4-amino-5-(trifluoromethyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(2,6-dichlorophenyl)acetamide |
| Molecular Weight: | 386.18 |
| Molecular Formula: | C11 H8 Cl2 F3 N5 O S |
| Smiles: | C(C(Nc1c(cccc1[Cl])[Cl])=O)Sc1nnc(C(F)(F)F)n1N |
| Stereo: | ACHIRAL |
| logP: | 2.6628 |
| logD: | 2.6527 |
| logSw: | -3.4311 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 64.165 |
| InChI Key: | NCLLVVMBJQSJGV-UHFFFAOYSA-N |