4,4'-(1,4-phenylene)bis[6-amino-3-(4-fluorophenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile]
Chemical Structure Depiction of
4,4'-(1,4-phenylene)bis[6-amino-3-(4-fluorophenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile]
4,4'-(1,4-phenylene)bis[6-amino-3-(4-fluorophenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile]
Compound characteristics
| Compound ID: | 8012-7390 |
| Compound Name: | 4,4'-(1,4-phenylene)bis[6-amino-3-(4-fluorophenyl)-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile] |
| Molecular Weight: | 586.56 |
| Molecular Formula: | C32 H20 F2 N8 O2 |
| Smiles: | C(C1C(c2ccc(cc2)C2C(C#N)=C(N)Oc3c2c(c2ccc(cc2)F)n[nH]3)c2c(c3ccc(cc3)F)n[nH]c2OC=1N)#N |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.7376 |
| logD: | 3.7375 |
| logSw: | -4.4786 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 6 |
| Polar surface area: | 140.708 |
| InChI Key: | OGMRHIAQPIJOCU-UHFFFAOYSA-N |