N-[(adamantan-1-yl)methyl]-4-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
N-[(adamantan-1-yl)methyl]-4-methoxybenzene-1-sulfonamide
N-[(adamantan-1-yl)methyl]-4-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8012-8016 |
| Compound Name: | N-[(adamantan-1-yl)methyl]-4-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 335.46 |
| Molecular Formula: | C18 H25 N O3 S |
| Smiles: | COc1ccc(cc1)S(NCC12CC3CC(CC(C3)C2)C1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5122 |
| logD: | 4.5122 |
| logSw: | -4.2986 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.574 |
| InChI Key: | BMGKNTHARDTQOJ-UHFFFAOYSA-N |