2-(2-butoxyanilino)-4-oxo-4-phenylbut-2-enoic acid
Chemical Structure Depiction of
2-(2-butoxyanilino)-4-oxo-4-phenylbut-2-enoic acid
2-(2-butoxyanilino)-4-oxo-4-phenylbut-2-enoic acid
Compound characteristics
| Compound ID: | 8012-8376 |
| Compound Name: | 2-(2-butoxyanilino)-4-oxo-4-phenylbut-2-enoic acid |
| Molecular Weight: | 339.39 |
| Molecular Formula: | C20 H21 N O4 |
| Smiles: | CCCCOc1ccccc1NC(=C\C(c1ccccc1)=O)\C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4435 |
| logD: | 4.4435 |
| logSw: | -4.204 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.446 |
| InChI Key: | AGNRHEPBUZHTHI-UHFFFAOYSA-N |