2-{[5-(furan-2-yl)-4-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}-1-(4-hydroxyphenyl)ethan-1-one
Chemical Structure Depiction of
2-{[5-(furan-2-yl)-4-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}-1-(4-hydroxyphenyl)ethan-1-one
2-{[5-(furan-2-yl)-4-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}-1-(4-hydroxyphenyl)ethan-1-one
Compound characteristics
| Compound ID: | 8012-8455 |
| Compound Name: | 2-{[5-(furan-2-yl)-4-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}-1-(4-hydroxyphenyl)ethan-1-one |
| Molecular Weight: | 315.35 |
| Molecular Formula: | C15 H13 N3 O3 S |
| Smiles: | Cn1c(c2ccco2)nnc1SCC(c1ccc(cc1)O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6718 |
| logD: | 1.5792 |
| logSw: | -1.9674 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.493 |
| InChI Key: | VGJOWGZXYTWOOP-UHFFFAOYSA-N |