4,4,6,9-tetramethyl-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione
Chemical Structure Depiction of
4,4,6,9-tetramethyl-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione
4,4,6,9-tetramethyl-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione
Compound characteristics
| Compound ID: | 8012-8898 |
| Compound Name: | 4,4,6,9-tetramethyl-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione |
| Molecular Weight: | 241.29 |
| Molecular Formula: | C15 H15 N O2 |
| Smiles: | CC1=CC(C)(C)N2C(C(c3c(C)ccc1c23)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8947 |
| logD: | 2.8947 |
| logSw: | -3.2762 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.8393 |
| InChI Key: | UTFJBEHZXBEQGY-UHFFFAOYSA-N |