N-[1-(4-chlorophenyl)-3-{[2-(2-methyl-1H-indol-3-yl)ethyl]amino}-3-oxoprop-1-en-2-yl]benzamide
Chemical Structure Depiction of
N-[1-(4-chlorophenyl)-3-{[2-(2-methyl-1H-indol-3-yl)ethyl]amino}-3-oxoprop-1-en-2-yl]benzamide
N-[1-(4-chlorophenyl)-3-{[2-(2-methyl-1H-indol-3-yl)ethyl]amino}-3-oxoprop-1-en-2-yl]benzamide
Compound characteristics
| Compound ID: | 8012-8935 |
| Compound Name: | N-[1-(4-chlorophenyl)-3-{[2-(2-methyl-1H-indol-3-yl)ethyl]amino}-3-oxoprop-1-en-2-yl]benzamide |
| Molecular Weight: | 457.96 |
| Molecular Formula: | C27 H24 Cl N3 O2 |
| Smiles: | Cc1c(CCNC(/C(=C/c2ccc(cc2)[Cl])NC(c2ccccc2)=O)=O)c2ccccc2[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 4.8895 |
| logD: | 3.8638 |
| logSw: | -5.1098 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 56.344 |
| InChI Key: | NCHYTPJLUWFIFU-UHFFFAOYSA-N |