N-[(adamantan-1-yl)methyl]-6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonamide
					Chemical Structure Depiction of
N-[(adamantan-1-yl)methyl]-6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonamide
			N-[(adamantan-1-yl)methyl]-6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonamide
Compound characteristics
| Compound ID: | 8012-9007 | 
| Compound Name: | N-[(adamantan-1-yl)methyl]-6-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonamide | 
| Molecular Weight: | 353.44 | 
| Molecular Formula: | C16 H23 N3 O4 S | 
| Smiles: | CC1=C(C(NC(N1)=O)=O)S(NCC12CC3CC(CC(C3)C2)C1)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 1.9058 | 
| logD: | -0.8615 | 
| logSw: | -2.5224 | 
| Hydrogen bond acceptors count: | 9 | 
| Hydrogen bond donors count: | 3 | 
| Polar surface area: | 90.564 | 
| InChI Key: | ZAQUITQEDNPMAC-UHFFFAOYSA-N | 
 
				 
				