5-methyl-N-[(pyridin-4-yl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide
Chemical Structure Depiction of
5-methyl-N-[(pyridin-4-yl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide
5-methyl-N-[(pyridin-4-yl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide
Compound characteristics
| Compound ID: | 8012-9054 |
| Compound Name: | 5-methyl-N-[(pyridin-4-yl)methyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| Molecular Weight: | 320.39 |
| Molecular Formula: | C13 H12 N4 O2 S2 |
| Smiles: | Cc1ccc2c(c1S(NCc1ccncc1)(=O)=O)nsn2 |
| Stereo: | ACHIRAL |
| logP: | 1.8377 |
| logD: | 1.5323 |
| logSw: | -2.1687 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.378 |
| InChI Key: | ADDPOAUFPUHRIN-UHFFFAOYSA-N |