N-(2,3-dimethylphenyl)-4-(2-{[3-(4-fluorophenyl)-1H-pyrazol-4-yl]methylidene}hydrazinyl)-6-(4-methylpiperidin-1-yl)-1,3,5-triazin-2-amine
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-4-(2-{[3-(4-fluorophenyl)-1H-pyrazol-4-yl]methylidene}hydrazinyl)-6-(4-methylpiperidin-1-yl)-1,3,5-triazin-2-amine
N-(2,3-dimethylphenyl)-4-(2-{[3-(4-fluorophenyl)-1H-pyrazol-4-yl]methylidene}hydrazinyl)-6-(4-methylpiperidin-1-yl)-1,3,5-triazin-2-amine
Compound characteristics
| Compound ID: | 8012-9071 |
| Compound Name: | N-(2,3-dimethylphenyl)-4-(2-{[3-(4-fluorophenyl)-1H-pyrazol-4-yl]methylidene}hydrazinyl)-6-(4-methylpiperidin-1-yl)-1,3,5-triazin-2-amine |
| Molecular Weight: | 499.59 |
| Molecular Formula: | C27 H30 F N9 |
| Smiles: | CC1CCN(CC1)c1nc(Nc2cccc(C)c2C)nc(N/N=C/c2c[nH]nc2c2ccc(cc2)F)n1 |
| Stereo: | ACHIRAL |
| logP: | 7.5952 |
| logD: | 7.5934 |
| logSw: | -6.0711 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 88.294 |
| InChI Key: | YOGRWDHMKMYRDL-UHFFFAOYSA-N |