methyl 4-(3-{[2-(adamantan-1-yl)ethyl]amino}-2,5-dioxopyrrolidin-1-yl)benzoate
Chemical Structure Depiction of
methyl 4-(3-{[2-(adamantan-1-yl)ethyl]amino}-2,5-dioxopyrrolidin-1-yl)benzoate
methyl 4-(3-{[2-(adamantan-1-yl)ethyl]amino}-2,5-dioxopyrrolidin-1-yl)benzoate
Compound characteristics
| Compound ID: | 8012-9119 |
| Compound Name: | methyl 4-(3-{[2-(adamantan-1-yl)ethyl]amino}-2,5-dioxopyrrolidin-1-yl)benzoate |
| Molecular Weight: | 410.51 |
| Molecular Formula: | C24 H30 N2 O4 |
| Smiles: | COC(c1ccc(cc1)N1C(CC(C1=O)NCCC12CC3CC(CC(C3)C2)C1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0081 |
| logD: | 3.008 |
| logSw: | -3.395 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.958 |
| InChI Key: | ADRMXWZYTIGXGZ-ZDCBYCKXSA-N |