N-benzyl-2,5-dichloro-4,6-dimethylpyridine-3-carboxamide
Chemical Structure Depiction of
N-benzyl-2,5-dichloro-4,6-dimethylpyridine-3-carboxamide
N-benzyl-2,5-dichloro-4,6-dimethylpyridine-3-carboxamide
Compound characteristics
| Compound ID: | 8013-0397 |
| Compound Name: | N-benzyl-2,5-dichloro-4,6-dimethylpyridine-3-carboxamide |
| Molecular Weight: | 309.19 |
| Molecular Formula: | C15 H14 Cl2 N2 O |
| Smiles: | Cc1c(C(NCc2ccccc2)=O)c(nc(C)c1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.6233 |
| logD: | 3.6092 |
| logSw: | -4.6793 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.482 |
| InChI Key: | XIBYMUJVJSMNPQ-UHFFFAOYSA-N |