2,5-dichloro-N-(2-ethylphenyl)-4,6-dimethylpyridine-3-carboxamide
Chemical Structure Depiction of
2,5-dichloro-N-(2-ethylphenyl)-4,6-dimethylpyridine-3-carboxamide
2,5-dichloro-N-(2-ethylphenyl)-4,6-dimethylpyridine-3-carboxamide
Compound characteristics
| Compound ID: | 8013-0399 |
| Compound Name: | 2,5-dichloro-N-(2-ethylphenyl)-4,6-dimethylpyridine-3-carboxamide |
| Molecular Weight: | 323.22 |
| Molecular Formula: | C16 H16 Cl2 N2 O |
| Smiles: | CCc1ccccc1NC(c1c(C)c(c(C)nc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.782 |
| logD: | 4.7555 |
| logSw: | -5.0544 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.462 |
| InChI Key: | WSBVPEBNCNPMOB-UHFFFAOYSA-N |