6-acetyl-3,5-di(furan-2-yl)cyclohex-2-en-1-one
Chemical Structure Depiction of
6-acetyl-3,5-di(furan-2-yl)cyclohex-2-en-1-one
6-acetyl-3,5-di(furan-2-yl)cyclohex-2-en-1-one
Compound characteristics
| Compound ID: | 8013-0487 |
| Compound Name: | 6-acetyl-3,5-di(furan-2-yl)cyclohex-2-en-1-one |
| Molecular Weight: | 270.28 |
| Molecular Formula: | C16 H14 O4 |
| Smiles: | CC(C1C(CC(=CC1=O)c1ccco1)c1ccco1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.1227 |
| logD: | 2.1075 |
| logSw: | -2.8367 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.119 |
| InChI Key: | OEEQYCSXFQYANO-UHFFFAOYSA-N |