N-[5-(benzenesulfonyl)-4-hydroxy-2-methylphenyl]-4-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
N-[5-(benzenesulfonyl)-4-hydroxy-2-methylphenyl]-4-methoxybenzene-1-sulfonamide
N-[5-(benzenesulfonyl)-4-hydroxy-2-methylphenyl]-4-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8013-0701 |
| Compound Name: | N-[5-(benzenesulfonyl)-4-hydroxy-2-methylphenyl]-4-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 433.5 |
| Molecular Formula: | C20 H19 N O6 S2 |
| Smiles: | Cc1cc(c(cc1NS(c1ccc(cc1)OC)(=O)=O)S(c1ccccc1)(=O)=O)O |
| Stereo: | ACHIRAL |
| logP: | 3.1643 |
| logD: | 3.1079 |
| logSw: | -3.2111 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 93.783 |
| InChI Key: | UDHZEAXIQZFASG-UHFFFAOYSA-N |