2,6-dichloro-N-(4-ethylphenyl)-4-methylpyridine-3-carboxamide
Chemical Structure Depiction of
2,6-dichloro-N-(4-ethylphenyl)-4-methylpyridine-3-carboxamide
2,6-dichloro-N-(4-ethylphenyl)-4-methylpyridine-3-carboxamide
Compound characteristics
| Compound ID: | 8013-1164 |
| Compound Name: | 2,6-dichloro-N-(4-ethylphenyl)-4-methylpyridine-3-carboxamide |
| Molecular Weight: | 309.19 |
| Molecular Formula: | C15 H14 Cl2 N2 O |
| Smiles: | CCc1ccc(cc1)NC(c1c(C)cc(nc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.7472 |
| logD: | 4.6991 |
| logSw: | -4.9687 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.45 |
| InChI Key: | KDAWIIGSEMRTOV-UHFFFAOYSA-N |