3-benzyl-6-phenyl-3,6-dihydro-7H-[1,2,3]triazolo[4,5-d]pyrimidin-7-one
Chemical Structure Depiction of
3-benzyl-6-phenyl-3,6-dihydro-7H-[1,2,3]triazolo[4,5-d]pyrimidin-7-one
3-benzyl-6-phenyl-3,6-dihydro-7H-[1,2,3]triazolo[4,5-d]pyrimidin-7-one
Compound characteristics
| Compound ID: | 8013-1755 |
| Compound Name: | 3-benzyl-6-phenyl-3,6-dihydro-7H-[1,2,3]triazolo[4,5-d]pyrimidin-7-one |
| Molecular Weight: | 303.32 |
| Molecular Formula: | C17 H13 N5 O |
| Smiles: | C(c1ccccc1)n1c2c(C(N(C=N2)c2ccccc2)=O)nn1 |
| Stereo: | ACHIRAL |
| logP: | 1.8635 |
| logD: | 1.8429 |
| logSw: | -2.0158 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 52.576 |
| InChI Key: | WRTMNELQRQQCOI-UHFFFAOYSA-N |