ethyl 3-[(2,5-dimethoxybenzene-1-sulfonyl)amino]-3-(3-nitrophenyl)propanoate
Chemical Structure Depiction of
ethyl 3-[(2,5-dimethoxybenzene-1-sulfonyl)amino]-3-(3-nitrophenyl)propanoate
ethyl 3-[(2,5-dimethoxybenzene-1-sulfonyl)amino]-3-(3-nitrophenyl)propanoate
Compound characteristics
| Compound ID: | 8013-2110 |
| Compound Name: | ethyl 3-[(2,5-dimethoxybenzene-1-sulfonyl)amino]-3-(3-nitrophenyl)propanoate |
| Molecular Weight: | 438.45 |
| Molecular Formula: | C19 H22 N2 O8 S |
| Smiles: | CCOC(CC(c1cccc(c1)[N+]([O-])=O)NS(c1cc(ccc1OC)OC)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9686 |
| logD: | 2.9683 |
| logSw: | -3.5602 |
| Hydrogen bond acceptors count: | 14 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 110.555 |
| InChI Key: | RDYKOOCAMCNTFS-INIZCTEOSA-N |