methyl 2-[(benzenesulfonyl)amino]-4-(4-methylcyclohex-3-en-1-yl)-2-(trifluoromethyl)pent-4-enoate
Chemical Structure Depiction of
methyl 2-[(benzenesulfonyl)amino]-4-(4-methylcyclohex-3-en-1-yl)-2-(trifluoromethyl)pent-4-enoate
methyl 2-[(benzenesulfonyl)amino]-4-(4-methylcyclohex-3-en-1-yl)-2-(trifluoromethyl)pent-4-enoate
Compound characteristics
| Compound ID: | 8013-2312 |
| Compound Name: | methyl 2-[(benzenesulfonyl)amino]-4-(4-methylcyclohex-3-en-1-yl)-2-(trifluoromethyl)pent-4-enoate |
| Molecular Weight: | 431.47 |
| Molecular Formula: | C20 H24 F3 N O4 S |
| Smiles: | CC1CCC(CC=1)C(=C)CC(C(=O)OC)(C(F)(F)F)NS(c1ccccc1)(=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.3482 |
| logD: | 3.6566 |
| logSw: | -5.358 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.245 |
| InChI Key: | CYPGCXPAVMIZPQ-UHFFFAOYSA-N |