N-{4-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl}-2,2-diphenylacetamide
Chemical Structure Depiction of
N-{4-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl}-2,2-diphenylacetamide
N-{4-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl}-2,2-diphenylacetamide
Compound characteristics
| Compound ID: | 8013-2464 |
| Compound Name: | N-{4-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl}-2,2-diphenylacetamide |
| Molecular Weight: | 421.45 |
| Molecular Formula: | C26 H19 N3 O3 |
| Smiles: | c1ccc(cc1)C(C(Nc1ccc(cc1)c1nnc(c2ccco2)o1)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.8591 |
| logD: | 4.859 |
| logSw: | -5.003 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.881 |
| InChI Key: | MVNFAUPGPSNPTE-UHFFFAOYSA-N |