2-fluoro-N-[2,4,6-trioxo-1-phenyl-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl]benzamide
Chemical Structure Depiction of
2-fluoro-N-[2,4,6-trioxo-1-phenyl-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl]benzamide
2-fluoro-N-[2,4,6-trioxo-1-phenyl-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl]benzamide
Compound characteristics
| Compound ID: | 8013-2690 |
| Compound Name: | 2-fluoro-N-[2,4,6-trioxo-1-phenyl-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl]benzamide |
| Molecular Weight: | 448.33 |
| Molecular Formula: | C20 H12 F4 N4 O4 |
| Smiles: | c1ccc(cc1)N1C2=C(C(NC1=O)=O)C(C(N2)=O)(C(F)(F)F)NC(c1ccccc1F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9982 |
| logD: | -3.0596 |
| logSw: | -2.8217 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 89.602 |
| InChI Key: | IQLSZVMLAQTHNX-IBGZPJMESA-N |