N-benzyl-2-(8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)acetamide
Chemical Structure Depiction of
N-benzyl-2-(8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)acetamide
N-benzyl-2-(8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)acetamide
Compound characteristics
| Compound ID: | 8013-2913 |
| Compound Name: | N-benzyl-2-(8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)acetamide |
| Molecular Weight: | 361.79 |
| Molecular Formula: | C16 H16 Cl N5 O3 |
| Smiles: | CN1C(c2c(nc(n2CC(NCc2ccccc2)=O)[Cl])N(C)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8597 |
| logD: | 1.8597 |
| logSw: | -2.65 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.395 |
| InChI Key: | WVDUMBRSLZQIPL-UHFFFAOYSA-N |