3-(2,2-diphenylacetamido)-3-(4-methoxyphenyl)propanoic acid
Chemical Structure Depiction of
3-(2,2-diphenylacetamido)-3-(4-methoxyphenyl)propanoic acid
3-(2,2-diphenylacetamido)-3-(4-methoxyphenyl)propanoic acid
Compound characteristics
| Compound ID: | 8013-3234 |
| Compound Name: | 3-(2,2-diphenylacetamido)-3-(4-methoxyphenyl)propanoic acid |
| Molecular Weight: | 389.45 |
| Molecular Formula: | C24 H23 N O4 |
| Smiles: | COc1ccc(cc1)C(CC(O)=O)NC(C(c1ccccc1)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8891 |
| logD: | 1.2513 |
| logSw: | -4.1199 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.938 |
| InChI Key: | NQJNWGWGNKKSIY-NRFANRHFSA-N |