N~2~-(4-chlorobenzene-1-sulfonyl)-N~2~-[(2-fluorophenyl)methyl]-N-[(pyridin-4-yl)methyl]glycinamide
Chemical Structure Depiction of
N~2~-(4-chlorobenzene-1-sulfonyl)-N~2~-[(2-fluorophenyl)methyl]-N-[(pyridin-4-yl)methyl]glycinamide
N~2~-(4-chlorobenzene-1-sulfonyl)-N~2~-[(2-fluorophenyl)methyl]-N-[(pyridin-4-yl)methyl]glycinamide
Compound characteristics
| Compound ID: | 8013-3412 |
| Compound Name: | N~2~-(4-chlorobenzene-1-sulfonyl)-N~2~-[(2-fluorophenyl)methyl]-N-[(pyridin-4-yl)methyl]glycinamide |
| Molecular Weight: | 447.91 |
| Molecular Formula: | C21 H19 Cl F N3 O3 S |
| Smiles: | C(c1ccncc1)NC(CN(Cc1ccccc1F)S(c1ccc(cc1)[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.277 |
| logD: | 3.2736 |
| logSw: | -3.7005 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.242 |
| InChI Key: | OQFUVDLVMWOFAX-UHFFFAOYSA-N |