3-[1-(3,4-dimethylphenyl)-5-(4-methoxyphenyl)-1H-pyrrol-2-yl]propanoic acid
Chemical Structure Depiction of
3-[1-(3,4-dimethylphenyl)-5-(4-methoxyphenyl)-1H-pyrrol-2-yl]propanoic acid
3-[1-(3,4-dimethylphenyl)-5-(4-methoxyphenyl)-1H-pyrrol-2-yl]propanoic acid
Compound characteristics
| Compound ID: | 8013-3425 |
| Compound Name: | 3-[1-(3,4-dimethylphenyl)-5-(4-methoxyphenyl)-1H-pyrrol-2-yl]propanoic acid |
| Molecular Weight: | 349.43 |
| Molecular Formula: | C22 H23 N O3 |
| Smiles: | Cc1ccc(cc1C)n1c(CCC(O)=O)ccc1c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 5.3491 |
| logD: | 2.5353 |
| logSw: | -5.2387 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.323 |
| InChI Key: | LMLURRYYXKVUJI-UHFFFAOYSA-N |