[4-(3,4-dichlorophenyl)piperazin-1-yl](3,4-dimethoxyphenyl)methanone
Chemical Structure Depiction of
[4-(3,4-dichlorophenyl)piperazin-1-yl](3,4-dimethoxyphenyl)methanone
[4-(3,4-dichlorophenyl)piperazin-1-yl](3,4-dimethoxyphenyl)methanone
Compound characteristics
| Compound ID: | 8013-3899 |
| Compound Name: | [4-(3,4-dichlorophenyl)piperazin-1-yl](3,4-dimethoxyphenyl)methanone |
| Molecular Weight: | 395.28 |
| Molecular Formula: | C19 H20 Cl2 N2 O3 |
| Smiles: | COc1ccc(cc1OC)C(N1CCN(CC1)c1ccc(c(c1)[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.5604 |
| logD: | 3.5604 |
| logSw: | -3.9131 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.408 |
| InChI Key: | KOSSCHIMYSESCP-UHFFFAOYSA-N |