3,4,5-trimethoxy-N-(3-methylpent-1-yn-3-yl)benzamide
Chemical Structure Depiction of
3,4,5-trimethoxy-N-(3-methylpent-1-yn-3-yl)benzamide
3,4,5-trimethoxy-N-(3-methylpent-1-yn-3-yl)benzamide
Compound characteristics
| Compound ID: | 8013-4080 |
| Compound Name: | 3,4,5-trimethoxy-N-(3-methylpent-1-yn-3-yl)benzamide |
| Molecular Weight: | 291.35 |
| Molecular Formula: | C16 H21 N O4 |
| Smiles: | CCC(C)(C#C)NC(c1cc(c(c(c1)OC)OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4251 |
| logD: | 2.4251 |
| logSw: | -2.8558 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.659 |
| InChI Key: | ITWPFMVALYGYGM-MRXNPFEDSA-N |