N-[(adamantan-1-yl)methyl]-5-(4-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide
Chemical Structure Depiction of
N-[(adamantan-1-yl)methyl]-5-(4-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide
N-[(adamantan-1-yl)methyl]-5-(4-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide
Compound characteristics
| Compound ID: | 8013-4088 |
| Compound Name: | N-[(adamantan-1-yl)methyl]-5-(4-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| Molecular Weight: | 484.52 |
| Molecular Formula: | C26 H27 F3 N4 O2 |
| Smiles: | COc1ccc(cc1)c1cc(C(F)(F)F)n2c(cc(C(NCC34CC5CC(CC(C5)C4)C3)=O)n2)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.5302 |
| logD: | 6.5302 |
| logSw: | -5.6881 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.388 |
| InChI Key: | WKKYEASVLDHIFC-UHFFFAOYSA-N |