3-(3-bromobenzamido)-3-(4-ethoxy-3-methoxyphenyl)propanoic acid
Chemical Structure Depiction of
3-(3-bromobenzamido)-3-(4-ethoxy-3-methoxyphenyl)propanoic acid
3-(3-bromobenzamido)-3-(4-ethoxy-3-methoxyphenyl)propanoic acid
Compound characteristics
| Compound ID: | 8013-4455 |
| Compound Name: | 3-(3-bromobenzamido)-3-(4-ethoxy-3-methoxyphenyl)propanoic acid |
| Molecular Weight: | 422.27 |
| Molecular Formula: | C19 H20 Br N O5 |
| Smiles: | CCOc1ccc(cc1OC)C(CC(O)=O)NC(c1cccc(c1)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0701 |
| logD: | 0.4323 |
| logSw: | -3.272 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.507 |
| InChI Key: | XTULTIMLNQDAOX-HNNXBMFYSA-N |